izoikim4 izoikim4

26-02-2017
Mathematics

contestada

What is the least common denominator for the fractions and? 1/3 and 2/9

Respuesta :

amelia18 amelia18

26-02-2017

Hi! The answer is 9.
3 times 3=9
9 times 1=9

Answer Link

lovejuless99 lovejuless99

26-02-2017

The least common denominator is 9.

Answer Link

Otras preguntas

Green Consulting closes out its withdrawals, expenses, and revenue accounts at the end of each fiscal period. These accounts are called Multiple Choice Balance

Which describes speciation? the adaptation of an extinct species the formation of a new species the extinction of an existing species the grouping of a species

In which of the following decisions is a person likely to be rationally ignorant? a. deciding where to live b. deciding which mayoral candidate to vote for c. d

Which of the following is a statistical question? A. How many students attend Natasha's school? B. How many players are on Greg's football team? C. What volume

Use the formula for the area of a circle to find the area of the bull’s eye and the next ring together A. 22,686.5 mm2 O B. 31,400 mm2 O C. 452.39 mm O D. 314

Cold water at 20 degrees C and 5000 kg/hr is to be heated by hot water supplied at 80 degrees C and 10,000 kg/hr. You select from a manufacturer's catalog a she

suppose you are titrating vinegar, which is an acetic acid solution

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

what is the function of Krebs Cycle please help!!!!!

Ursula buys a Verismooth boat from a Watercraft store, which agrees to keep the boat for Ursula until she picks it up. Before Ursula gets the boat, an unforesee