shaaamir1eLma8yamili shaaamir1eLma8yamili

25-01-2017
Health

contestada

What precaution must you take with the beverage container, so you can drink from it while working in the kitchen? of the descriptions below which one would be allowed?

Respuesta :

084intheSkye 084intheSkye

25-01-2017

I'm not sure what the full question is here, but I would assume you should make sure there's a lid or that you don't spill it on the oven or floor.

Answer Link

Otras preguntas

What is the effect of the figurative language used in this excerpt? Choose three answers.

pedro collected temperature data from the

After writing off uncollectible accounts, a company reinstates and recovers an account for a customer. what will the entry include to record the recovery?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?

Is the state of the air in an isolated room completelyspecified by the temperature and the pressure? explain.

Plastic deformation is characterized by permanent _________, that is, the material (like a compressed snowball) doesn't return to its original shape.

D&g enterprises issues bonds with a $1,000 face value that make coupon payments of $30 every 3 months. what is the coupon rate?

________ sales force consists of manufacturers' reps, sales agents, and brokers who earn a commission based on sales.

3 The diameter of a regulation soccer ball is about 8 inches. This number was graphed on a number line A B C -6-5-4-3-2-1 0 1 2 3 4 5 6 7 8 9 Which point could

If the government wants to maximize the amount of tariff revenue it collects on any one good, it has to:_______.